methyl 1-(2-(3-(phenylsulfonyl)-1H-indol-1-yl)acetyl)piperidine-4-carboxylate
Modify Date: 2025-10-13 14:50:38
methyl 1-(2-(3-(phenylsulfonyl)-1H-indol-1-yl)acetyl)piperidine-4-carboxylate structure
|
Common Name | methyl 1-(2-(3-(phenylsulfonyl)-1H-indol-1-yl)acetyl)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 942003-72-7 | Molecular Weight | 440.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-(2-(3-(phenylsulfonyl)-1H-indol-1-yl)acetyl)piperidine-4-carboxylate |
|---|
| Molecular Formula | C23H24N2O5S |
|---|---|
| Molecular Weight | 440.5 |
| InChIKey | KXSGKNSUMINEJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(C(=O)Cn2cc(S(=O)(=O)c3ccccc3)c3ccccc32)CC1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1