Ethyl 4-(4-tert-butylbenzamido)-6-oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylate structure
|
Common Name | Ethyl 4-(4-tert-butylbenzamido)-6-oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 942009-79-2 | Molecular Weight | 419.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 4-(4-tert-butylbenzamido)-6-oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylate |
|---|
| Molecular Formula | C24H25N3O4 |
|---|---|
| Molecular Weight | 419.5 |
| InChIKey | SESBTIWMYOQEEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c(=O)cc1NC(=O)c1ccc(C(C)(C)C)cc1 |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|