methyltriphenylphosphonium, salt with 2,2'-methylenebis[3,4,6-trichlorophenol] (1:1) structure
|
Common Name | methyltriphenylphosphonium, salt with 2,2'-methylenebis[3,4,6-trichlorophenol] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94201-81-7 | Molecular Weight | 683.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H23Cl6O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl(triphenyl)phosphanium,3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H23Cl6O2P |
|---|---|
| Molecular Weight | 683.21600 |
| Exact Mass | 679.95700 |
| PSA | 56.88000 |
| LogP | 10.65750 |
| InChIKey | BJSXJZSQKPMJAZ-UHFFFAOYSA-M |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-]c1c(Cl)cc(Cl)c(Cl)c1Cc1c(O)c(Cl)cc(Cl)c1Cl |
| Methyltriphenylphosphonium,salt with 2,2'-methylenebis(3,4,6-trichlorophenol) (1:1) |
| EINECS 303-671-0 |