N-(2-(dimethylamino)-2-(naphthalen-1-yl)ethyl)-2,6-difluorobenzamide
Modify Date: 2026-08-14 12:42:51
N-(2-(dimethylamino)-2-(naphthalen-1-yl)ethyl)-2,6-difluorobenzamide structure
|
Common Name | N-(2-(dimethylamino)-2-(naphthalen-1-yl)ethyl)-2,6-difluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 942011-41-8 | Molecular Weight | 354.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20F2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-(dimethylamino)-2-(naphthalen-1-yl)ethyl)-2,6-difluorobenzamide |
|---|
| Molecular Formula | C21H20F2N2O |
|---|---|
| Molecular Weight | 354.4 |
| InChIKey | YAWFVQDSNBZUCE-UHFFFAOYSA-N |
| SMILES | CN(C)C(CNC(=O)c1c(F)cccc1F)c1cccc2ccccc12 |
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 2, Current Page 1 of 1
1