(5-chloro-2-nitrophenyl)(4-(3-(4-fluorophenyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl)methanone structure
|
Common Name | (5-chloro-2-nitrophenyl)(4-(3-(4-fluorophenyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 942012-95-5 | Molecular Weight | 482.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16ClFN8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-chloro-2-nitrophenyl)(4-(3-(4-fluorophenyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl)methanone |
|---|
| Molecular Formula | C21H16ClFN8O3 |
|---|---|
| Molecular Weight | 482.9 |
| InChIKey | ZBYNAXKNBHSMTJ-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N1CCN(c2ncnc3c2nnn3-c2ccc(F)cc2)CC1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|