[5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane
![[5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane Structure](https://image.chemsrc.com/caspic/423/942070-10-2.png)
[5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane structure
|
Common Name | [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 942070-10-2 | Molecular Weight | 316.72700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22BClO2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22BClO2SSi |
|---|---|
| Molecular Weight | 316.72700 |
| Exact Mass | 316.08900 |
| PSA | 46.70000 |
| LogP | 3.24590 |
| InChIKey | LXFOCXMLFUHGCM-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc([Si](C)(C)C)sc2Cl)OC1(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
[5-chloro-4-(4,... CAS#:942070-10-2 |
| Literature: Kallepalli, Venkata A.; Sanchez, Luis; Li, Hao; Gesmundo, Nathan J.; Turton, Clarissa L.; Maleczka Jr., Robert E.; Smith III, Milton R. Heterocycles, 2010 , vol. 80, # 2 p. 1429 - 1448 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)trimethylsilane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: CAS number of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is 942070-10-2. |
| Q: What is the English name of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: The English name of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane. |
| Q: What is the InChIKey of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: InChIKey of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is LXFOCXMLFUHGCM-UHFFFAOYSA-N. |
| Q: What English synonyms does [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane have? |
| A: English synonyms of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane: (5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)trimethylsilane. |
| Q: What is the SMILES notation of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: SMILES notation of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is CC1(C)OB(c2cc([Si](C)(C)C)sc2Cl)OC1(C)C. |
| Q: What is the polar surface area (PSA) of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: Polar surface area (PSA) of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is 46.70000. |
| Q: What is the LogP of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: LogP of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is 3.24590. |
| Q: What is the molecular formula of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: Molecular formula of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is C13H22BClO2SSi. |
| Q: What is the molecular weight of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane? |
| A: Molecular weight of [5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-trimethylsilane is 316.72700. |
| Q: What is the Chinese name of 942070-10-2? |
| A: Chinese name of 942070-10-2 is 942070-10-2. |