2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 942070-24-8 | Molecular Weight | 335.99700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14BIO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14BIO2S |
|---|---|
| Molecular Weight | 335.99700 |
| Exact Mass | 335.98500 |
| PSA | 46.70000 |
| LogP | 2.65190 |
| InChIKey | ZWPSZPYWMLNQGY-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc(I)s2)OC1(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
2-(5-iodothioph... CAS#:942070-24-8 |
| Literature: Chotana, Ghayoor A.; Kallepalli, Venkata A.; Maleczka Jr., Robert E.; Smith III, Milton R. Tetrahedron, 2008 , vol. 64, # 26 p. 6103 - 6114 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular weight of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 335.99700. |
| Q: What is the molecular formula of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular formula of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is C10H14BIO2S. |
| Q: What is the polar surface area (PSA) of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Polar surface area (PSA) of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 46.70000. |
| Q: What is the Chinese name of 942070-24-8? |
| A: Chinese name of 942070-24-8 is 942070-24-8. |
| Q: What is the CAS number of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: CAS number of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 942070-24-8. |
| Q: What is the SMILES notation of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: SMILES notation of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is CC1(C)OB(c2ccc(I)s2)OC1(C)C. |
| Q: What is the LogP of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: LogP of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2.65190. |
| Q: What is the InChIKey of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: InChIKey of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is ZWPSZPYWMLNQGY-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: The English name of 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2-(5-iodothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. |