7-anilino-4-hydroxy-3-[[6-methoxy-4-[(6-sulpho-2,4-xylyl)azo]-m-tolyl]azo]naphthalene-2-sulphonic acid, sodium salt, compound with 2,2',2''-nitrilotriethanol structure
|
Common Name | 7-anilino-4-hydroxy-3-[[6-methoxy-4-[(6-sulpho-2,4-xylyl)azo]-m-tolyl]azo]naphthalene-2-sulphonic acid, sodium salt, compound with 2,2',2''-nitrilotriethanol | ||
|---|---|---|---|---|
| CAS Number | 94213-53-3 | Molecular Weight | 868.88300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H42N6Na2O11S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | disodium,(3E)-7-anilino-3-[[4-[(2,4-dimethyl-6-sulfonatophenyl)diazenyl]-2-methoxy-5-methylphenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonate,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|
| Molecular Formula | C38H42N6Na2O11S2 |
|---|---|
| Molecular Weight | 868.88300 |
| Exact Mass | 868.21500 |
| PSA | 282.53000 |
| LogP | 6.80690 |
| InChIKey | CPOZXRHZDHMEPU-UHFFFAOYSA-M |
| SMILES | COc1cc(N=Nc2c(C)cc(C)cc2S(=O)(=O)[O-])c(C)cc1N=Nc1c(S(=O)(=O)[O-])cc2cc(Nc3ccccc3)ccc2c1O.OCC[NH+](CCO)CCO.[Na+] |