4-ethyl-2-(2-hydroxyethyl)-7-thia-2,4,10-triazabicyclo[4.4.0]dec-11-ene-3,5,9-trione structure
|
Common Name | 4-ethyl-2-(2-hydroxyethyl)-7-thia-2,4,10-triazabicyclo[4.4.0]dec-11-ene-3,5,9-trione | ||
|---|---|---|---|---|
| CAS Number | 94216-16-7 | Molecular Weight | 271.29300 | |
| Density | 1.56g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-1-(2-hydroxyethyl)-8H-pyrimido[5,4-b][1,4]thiazine-2,4,7-trione |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.29300 |
| Exact Mass | 271.06300 |
| PSA | 118.63000 |
| Index of Refraction | 1.675 |
| InChIKey | BWCXKIPRNSKJIN-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)c2c(n(CCO)c1=O)NC(=O)CS2 |
|
~%
4-ethyl-2-(2-hy... CAS#:94216-16-7 |
| Literature: Schroeder,E.F.; Dodson,R.M. Journal of the American Chemical Society, 1962 , vol. 84, p. 1904 - 1913 |