Thiosulfuric acid(H2S2O3), S-[2-imino-1-methyl-2-[(phenylmethyl)amino]ethyl] ester structure
|
Common Name | Thiosulfuric acid(H2S2O3), S-[2-imino-1-methyl-2-[(phenylmethyl)amino]ethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 94217-06-8 | Molecular Weight | 274.36000 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(1-amino-2-sulfosulfanylpropylidene)amino]methylbenzene |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.36000 |
| Exact Mass | 274.04500 |
| PSA | 123.93000 |
| LogP | 3.24940 |
| Index of Refraction | 1.617 |
| InChIKey | QXROTHHPIPHXIO-UHFFFAOYSA-N |
| SMILES | CC(SS(=O)(=O)O)C(N)=NCc1ccccc1 |
|
~%
Thiosulfuric ac... CAS#:94217-06-8 |
| Literature: Bauer,L.; Welsh,T.L. Journal of Organic Chemistry, 1962 , vol. 27, p. 4382 - 4385 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |