2-(N-Boc-methylamino)-5-iodo-3-methylpyridine structure
|
Common Name | 2-(N-Boc-methylamino)-5-iodo-3-methylpyridine | ||
|---|---|---|---|---|
| CAS Number | 942206-08-8 | Molecular Weight | 348.18000 | |
| Density | 1.523g/cm3 | Boiling Point | 380ºC at 760 mmHg | |
| Molecular Formula | C12H17IN2O2 | Melting Point | 97-100ºC | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | tert-butyl N-(5-iodo-3-methylpyridin-2-yl)-N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760 mmHg |
| Melting Point | 97-100ºC |
| Molecular Formula | C12H17IN2O2 |
| Molecular Weight | 348.18000 |
| Flash Point | 183.6ºC |
| Exact Mass | 348.03300 |
| PSA | 42.43000 |
| LogP | 3.36590 |
| Index of Refraction | 1.585 |
| InChIKey | HWHYESISLPNYCT-UHFFFAOYSA-N |
| SMILES | Cc1cc(I)cnc1N(C)C(=O)OC(C)(C)C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(n-boc-methylamino)-5-iodo-3-methylpyridine |
| 2-(tert-butyloxycarbonyl-methylamino)-5-iodo-3-methylpyridine |