2',6-Dibromo-3,4'-bipyridine
Modify Date: 2025-08-31 22:01:28
2',6-Dibromo-3,4'-bipyridine structure
|
Common Name | 2',6-Dibromo-3,4'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 942206-16-8 | Molecular Weight | 313.97600 | |
| Density | 1.809g/cm3 | Boiling Point | 386.2ºC at 760 mmHg | |
| Molecular Formula | C10H6Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.3ºC | |
| Name | 2-bromo-4-(6-bromopyridin-3-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.809g/cm3 |
|---|---|
| Boiling Point | 386.2ºC at 760 mmHg |
| Molecular Formula | C10H6Br2N2 |
| Molecular Weight | 313.97600 |
| Flash Point | 187.3ºC |
| Exact Mass | 311.89000 |
| PSA | 25.78000 |
| LogP | 3.66860 |
| Index of Refraction | 1.638 |
| InChIKey | LGVJILYMUFZGLC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2ccnc(Br)c2)cn1 |
| HS Code | 2933399090 |
|---|
|
~17%
2',6-Dibromo-3,... CAS#:942206-16-8 |
| Literature: Tetrahedron, , vol. 65, # 3 p. 607 - 612 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,2'-dibromo-[3,4']bipyridine |