2-chloro-4-(5-chloropyridin-2-yl)pyridine
Modify Date: 2025-08-31 21:21:50
2-chloro-4-(5-chloropyridin-2-yl)pyridine structure
|
Common Name | 2-chloro-4-(5-chloropyridin-2-yl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 942206-21-5 | Molecular Weight | 225.07400 | |
| Density | 1.363g/cm3 | Boiling Point | 333.8ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | 2-chloro-4-(5-chloropyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 333.8ºC at 760 mmHg |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.07400 |
| Flash Point | 185.9ºC |
| Exact Mass | 223.99100 |
| PSA | 25.78000 |
| LogP | 3.45040 |
| Index of Refraction | 1.604 |
| InChIKey | BKYODZNCPNKPOB-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2ccnc(Cl)c2)nc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,2'-dichloro-2,4'-bipyridine |