benzyltriphenylphosphonium, salt with 4-bromo-2,6-xylenol (1:1) structure
|
Common Name | benzyltriphenylphosphonium, salt with 4-bromo-2,6-xylenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94231-10-4 | Molecular Weight | 553.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H30BrOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl(triphenyl)phosphanium,4-bromo-2,6-dimethylphenolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H30BrOP |
|---|---|
| Molecular Weight | 553.46800 |
| Exact Mass | 552.12200 |
| PSA | 36.65000 |
| LogP | 8.39040 |
| InChIKey | SUFZFDLJMKKCNN-UHFFFAOYSA-M |
| SMILES | Cc1cc(Br)cc(C)c1[O-].c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| EINECS 303-824-1 |
| Benzyltriphenylphosphonium,salt with 4-bromo-2,6-xylenol (1:1) |