tetraphenylphosphonium, salt with 2-tert-butylphenol (1:1) structure
|
Common Name | tetraphenylphosphonium, salt with 2-tert-butylphenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94231-23-9 | Molecular Weight | 488.59900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H33OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butylphenolate,tetraphenylphosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H33OP |
|---|---|
| Molecular Weight | 488.59900 |
| Exact Mass | 488.22700 |
| PSA | 36.65000 |
| LogP | 7.43390 |
| InChIKey | PWCDHYFORIAMHF-UHFFFAOYSA-M |
| SMILES | CC(C)(C)c1ccccc1[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| EINECS 303-838-8 |
| Tetraphenylphosphonium,salt with 2-tert-butylphenol (1:1) |