6-(benzoylmethylamino)hexanoic acid
6-(benzoylmethylamino)hexanoic acid structure
|
Common Name | 6-(benzoylmethylamino)hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 94231-67-1 | Molecular Weight | 249.30600 | |
| Density | 1.115g/cm3 | Boiling Point | 433.9ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(phenacylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 433.9ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 216.2ºC |
| Exact Mass | 249.13600 |
| PSA | 66.40000 |
| LogP | 2.49480 |
| Index of Refraction | 1.531 |
| InChIKey | CXANSQSOXRVOKL-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)C(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-(benzoylmethy... CAS#:94231-67-1 |
| Literature: Neuberger; Sanger Biochemical Journal, 1944 , vol. 38, p. 125,127 Full Text Show Details Enger; Steib Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1930 , vol. 191, p. 97,100 |
|
~%
6-(benzoylmethy... CAS#:94231-67-1 |
| Literature: Poduska Collection of Czechoslovak Chemical Communications, 1959 , vol. 24, p. 1025 |
![Hexanoic acid,6-[methyl[(4-methylphenyl)sulfonyl]amino] structure](https://image.chemsrc.com/caspic/352/6954-30-9.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-(Benzoyl-methyl-amino)-hexansaeure |
| 6-(benzoyl-methyl-amino)-hexanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-(phenacylamino)hexanoic acid? |
| A: Molecular formula of 6-(phenacylamino)hexanoic acid is C14H19NO3. |
| Q: What is the LogP of 6-(phenacylamino)hexanoic acid? |
| A: LogP of 6-(phenacylamino)hexanoic acid is 2.49480. |
| Q: What English synonyms does 6-(phenacylamino)hexanoic acid have? |
| A: English synonyms of 6-(phenacylamino)hexanoic acid: 6-(Benzoyl-methyl-amino)-hexansaeure, 6-(benzoyl-methyl-amino)-hexanoic acid. |
| Q: What is the InChIKey of 6-(phenacylamino)hexanoic acid? |
| A: InChIKey of 6-(phenacylamino)hexanoic acid is CXANSQSOXRVOKL-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 6-(phenacylamino)hexanoic acid? |
| A: Polar surface area (PSA) of 6-(phenacylamino)hexanoic acid is 66.40000. |
| Q: What is the English name of 6-(phenacylamino)hexanoic acid? |
| A: The English name of 6-(phenacylamino)hexanoic acid is 6-(phenacylamino)hexanoic acid. |
| Q: What is the Chinese name of 94231-67-1? |
| A: Chinese name of 94231-67-1 is 94231-67-1. |
| Q: What is the CAS number of 6-(phenacylamino)hexanoic acid? |
| A: CAS number of 6-(phenacylamino)hexanoic acid is 94231-67-1. |
| Q: What is the SMILES notation of 6-(phenacylamino)hexanoic acid? |
| A: SMILES notation of 6-(phenacylamino)hexanoic acid is CN(CCCCCC(=O)O)C(=O)c1ccccc1. |
| Q: What is the molecular weight of 6-(phenacylamino)hexanoic acid? |
| A: Molecular weight of 6-(phenacylamino)hexanoic acid is 249.30600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |