6-(N-methylbenzamido)hexanoic acid, compound with cyclohexylamine (1:1) structure
|
Common Name | 6-(N-methylbenzamido)hexanoic acid, compound with cyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94231-68-2 | Molecular Weight | 348.48000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H32N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[benzoyl(methyl)amino]hexanoic acid,cyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H32N2O3 |
|---|---|
| Molecular Weight | 348.48000 |
| Exact Mass | 348.24100 |
| PSA | 83.63000 |
| LogP | 4.38170 |
| InChIKey | URINDTXWTIKGGU-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)C(=O)c1ccccc1.NC1CCCCC1 |
| 6-(N-Methylbenzamido)hexanoic acid,compound with cyclohexylamine (1:1) |
| EINECS 303-888-0 |