dinonylnaphthalenedisulphonic acid, compound with 2-(dimethylamino)ethanol (1:1) structure
|
Common Name | dinonylnaphthalenedisulphonic acid, compound with 2-(dimethylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94233-61-1 | Molecular Weight | 629.91200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H55NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dimethylamino)ethanol,3,4-di(nonyl)naphthalene-1,2-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H55NO7S2 |
|---|---|
| Molecular Weight | 629.91200 |
| Exact Mass | 629.34200 |
| PSA | 148.97000 |
| LogP | 9.62130 |
| InChIKey | XFWWJISKAHTKPI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc2c1CCCCCCCCC.CN(C)CCO |
| Dinonylnaphthalenedisulphonic acid,compound with 2-(dimethylamino)ethanol (1:1) |
| EINECS 304-072-7 |