3-hydroxy-4-[[4-(phenylazo)phenyl]azo]naphthalene-2,7-disulphonic acid, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:2) structure
|
Common Name | 3-hydroxy-4-[[4-(phenylazo)phenyl]azo]naphthalene-2,7-disulphonic acid, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 94236-79-0 | Molecular Weight | 995.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H86N6O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethyl-N-(2-ethylhexyl)hexan-1-amine,(4Z)-3-oxo-4-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalene-2,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C54H86N6O7S2 |
|---|---|
| Molecular Weight | 995.42700 |
| Exact Mass | 994.60000 |
| PSA | 215.74000 |
| LogP | 17.01030 |
| InChIKey | WRPIXEBTBYXEHW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CNCC(CC)CCCC.CCCCC(CC)CNCC(CC)CCCC.O=S(=O)(O)c1ccc2c(N=Nc3ccc(N=Nc4ccccc4)cc3)c(O)c(S(=O)(=O)O)cc2c1 |
| EINECS 304-075-3 |
| 3-Hydroxy-4-((4-(phenylazo)phenyl)azo)naphthalene-2,7-disulphonic acid,compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:2) |