Einecs 304-136-4
Modify Date: 2026-06-30 18:01:16
Einecs 304-136-4 structure
|
Common Name | Einecs 304-136-4 | ||
|---|---|---|---|---|
| CAS Number | 94237-40-8 | Molecular Weight | 1171.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C63H88NaO17P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Einecs 304-136-4 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C63H88NaO17P |
|---|---|
| Molecular Weight | 1171.3 |
| InChIKey | QTLGBHRQFJSKQT-ABDXRJAGSA-M |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO.CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)COP(=O)([O-])OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 94237-40-8? |
| A: Chinese name of 94237-40-8 is 94237-40-8. |
| Q: What is the molecular weight of Einecs 304-136-4? |
| A: Molecular weight of Einecs 304-136-4 is 1171.3. |
| Q: What is the molecular formula of Einecs 304-136-4? |
| A: Molecular formula of Einecs 304-136-4 is C63H88NaO17P. |
| Q: What is the InChIKey of Einecs 304-136-4? |
| A: InChIKey of Einecs 304-136-4 is QTLGBHRQFJSKQT-ABDXRJAGSA-M. |
| Q: What is the SMILES notation of Einecs 304-136-4? |
| A: SMILES notation of Einecs 304-136-4 is CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO.CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)COP(=O)([O-])OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C.[Na+]. |
| Q: What is the English name of Einecs 304-136-4? |
| A: The English name of Einecs 304-136-4 is Einecs 304-136-4. |
| Q: What is the CAS number of Einecs 304-136-4? |
| A: CAS number of Einecs 304-136-4 is 94237-40-8. |