ethyl 2-(5-bromo-2-formylphenoxy)acetate structure
|
Common Name | ethyl 2-(5-bromo-2-formylphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 942414-81-5 | Molecular Weight | 287.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(5-bromo-2-formylphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrO4 |
|---|---|
| Molecular Weight | 287.10700 |
| Exact Mass | 285.98400 |
| PSA | 52.60000 |
| LogP | 2.20350 |
| InChIKey | OVGQAUDSJKCXBY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1cc(Br)ccc1C=O |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| qc-1031 |