methyl 2-chloro-2-(5-chloro-2-methoxy-3-methylphenyl)acetate
Modify Date: 2025-09-18 12:48:36
methyl 2-chloro-2-(5-chloro-2-methoxy-3-methylphenyl)acetate structure
|
Common Name | methyl 2-chloro-2-(5-chloro-2-methoxy-3-methylphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 94242-10-1 | Molecular Weight | 263.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-chloro-2-(5-chloro-2-methoxy-3-methylphenyl)acetate |
|---|
| Molecular Formula | C11H12Cl2O3 |
|---|---|
| Molecular Weight | 263.11700 |
| Exact Mass | 262.01600 |
| PSA | 35.53000 |
| LogP | 3.10990 |
| InChIKey | AVPLKXFWAHXGJD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cl)c1cc(Cl)cc(C)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |