Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate
Modify Date: 2025-09-10 19:24:30
Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate structure
|
Common Name | Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 942425-70-9 | Molecular Weight | 269.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H23NO4 |
|---|---|
| Molecular Weight | 269.34 |
| InChIKey | ITGCCWJBYYYGSN-UHFFFAOYSA-N |
| SMILES | CC(C)CC1CC(=O)CC(=O)N1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate? |
| A: InChIKey of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate is ITGCCWJBYYYGSN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate? |
| A: SMILES notation of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate is CC(C)CC1CC(=O)CC(=O)N1C(=O)OC(C)(C)C. |
| Q: What is the English name of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate? |
| A: The English name of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate is Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate. |
| Q: What is the molecular weight of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate? |
| A: Molecular weight of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate is 269.34. |
| Q: What is the CAS number of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate? |
| A: CAS number of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate is 942425-70-9. |
| Q: What is the Chinese name of 942425-70-9? |
| A: Chinese name of 942425-70-9 is 942425-70-9. |
| Q: What is the molecular formula of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate? |
| A: Molecular formula of Tert-butyl 2-isobutyl-4,6-dioxopiperidine-1-carboxylate is C14H23NO4. |