Carbanilic acid,4-[2-(diethylamino)acetamido]-3,5-dimethyl-, propyl ester (7CI) structure
|
Common Name | Carbanilic acid,4-[2-(diethylamino)acetamido]-3,5-dimethyl-, propyl ester (7CI) | ||
|---|---|---|---|---|
| CAS Number | 94262-08-5 | Molecular Weight | 335.44100 | |
| Density | 1.115g/cm3 | Boiling Point | 428.5ºC at 760mmHg | |
| Molecular Formula | C18H29N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.9ºC | |
| Name | propyl N-[4-[(2-diethylaminoacetyl)amino]-3,5-dimethylphenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 428.5ºC at 760mmHg |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.44100 |
| Flash Point | 212.9ºC |
| Exact Mass | 335.22100 |
| PSA | 70.67000 |
| LogP | 3.68820 |
| Index of Refraction | 1.563 |
| InChIKey | GRDDSRDJVYDZFF-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)Nc1cc(C)c(NC(=O)CN(CC)CC)c(C)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Carbanilic acid... CAS#:94262-08-5 |
| Literature: Tegner,C.; Willman,N.-E. Acta Chemica Scandinavica (1947-1973), 1960 , vol. 14, p. 885 - 892 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| propyl N-[4-[(2-diethylaminoacetyl)amino]-3,5-dimethyl-phenyl]carbamat e |
| 4-Diethylamino-acetamido-3,5-dimethylphenyl-carbaminsaeure-propylester |