2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile
Modify Date: 2026-09-21 20:08:31
![2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile Structure](https://www.chemsrc.com/extcaspic/078/942631-86-9.png)
2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile structure
|
Common Name | 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 942631-86-9 | Molecular Weight | 211.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9NO2 |
|---|---|
| Molecular Weight | 211.22 |
| InChIKey | YUKRLNZZPVSLGJ-UHFFFAOYSA-N |
| SMILES | N#Cc1cccc2cc3c(cc12)OCCO3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile? |
| A: Molecular formula of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile is C13H9NO2. |
| Q: What is the Chinese name of 942631-86-9? |
| A: Chinese name of 942631-86-9 is 942631-86-9. |
| Q: What is the molecular weight of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile? |
| A: Molecular weight of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile is 211.22. |
| Q: What is the CAS number of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile? |
| A: CAS number of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile is 942631-86-9. |
| Q: What is the InChIKey of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile? |
| A: InChIKey of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile is YUKRLNZZPVSLGJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile? |
| A: SMILES notation of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile is N#Cc1cccc2cc3c(cc12)OCCO3. |
| Q: What is the English name of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile? |
| A: The English name of 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile is 2,3-Dihydronaphtho[2,3-b][1,4]dioxine-6-carbonitrile. |