tris[3-(dimethylamino)-2,2-dimethylpropyl] orthoborate structure
|
Common Name | tris[3-(dimethylamino)-2,2-dimethylpropyl] orthoborate | ||
|---|---|---|---|---|
| CAS Number | 94266-00-9 | Molecular Weight | 401.435 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 414.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H48BN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.4±27.3 °C | |
| Name | Tris[3-(dimethylamino)-2,2-dimethylpropyl] borate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.4±40.0 °C at 760 mmHg |
| Molecular Formula | C21H48BN3O3 |
| Molecular Weight | 401.435 |
| Flash Point | 204.4±27.3 °C |
| Exact Mass | 401.378876 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | ZOMVQCXUYPVEPS-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C)(C)COB(OCC(C)(C)CN(C)C)OCC(C)(C)CN(C)C |
| EINECS 304-406-1 |
| Tris[3-(dimethylamino)-2,2-dimethylpropyl] borate |
| 1-Propanol, 3-(dimethylamino)-2,2-dimethyl-, triester with boric acid (H3BO3) |