4-[4-[3-[4-(dimethylamino)phenyl]allylidene]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid, compound with pyridine (1:1) structure
|
Common Name | 4-[4-[3-[4-(dimethylamino)phenyl]allylidene]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid, compound with pyridine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94266-10-1 | Molecular Weight | 490.57400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H26N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid,pyridine |
|---|
| Molecular Formula | C26H26N4O4S |
|---|---|
| Molecular Weight | 490.57400 |
| Exact Mass | 490.16700 |
| PSA | 111.55000 |
| LogP | 5.02460 |
| InChIKey | LYFKIIXRPZYASN-UCFPASQTSA-N |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1=CC=Cc1ccc(N(C)C)cc1.c1ccncc1 |