4-[3-[4-(dimethylamino)phenyl]allylidene]-4,5-dihydro-5-oxo-1-(4-sulphophenyl)-1H-pyrazole-3-carboxylic acid, compound with pyridine (1:1) structure
|
Common Name | 4-[3-[4-(dimethylamino)phenyl]allylidene]-4,5-dihydro-5-oxo-1-(4-sulphophenyl)-1H-pyrazole-3-carboxylic acid, compound with pyridine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94266-13-4 | Molecular Weight | 520.55700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid,pyridine |
|---|
| Molecular Formula | C26H24N4O6S |
|---|---|
| Molecular Weight | 520.55700 |
| Exact Mass | 520.14200 |
| PSA | 148.85000 |
| LogP | 4.08930 |
| InChIKey | XUTSHOFIPMCVIH-PQXOWKIQSA-N |
| SMILES | CN(C)c1ccc(C=CC=C2C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C(=O)O)cc1.c1ccncc1 |