diethyl 2-[1-[dimethyl(phenyl)silyl]cyclopentyl]propanedioate structure
|
Common Name | diethyl 2-[1-[dimethyl(phenyl)silyl]cyclopentyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 94286-39-2 | Molecular Weight | 362.53500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[1-[dimethyl(phenyl)silyl]cyclopentyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H30O4Si |
|---|---|
| Molecular Weight | 362.53500 |
| Exact Mass | 362.19100 |
| PSA | 52.60000 |
| LogP | 3.65880 |
| InChIKey | LUUVZMXQSWTQSY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C1([Si](C)(C)c2ccccc2)CCCC1 |
|
~70%
diethyl 2-[1-[d... CAS#:94286-39-2 |
| Literature: Fleming, Ian; Waterson, David Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 8 p. 1809 - 1813 |
| Propanedioic acid,[1-(dimethylphenylsilyl)cyclopentyl]-,diethyl ester |
| diethyl 2-<1-(dimethylphenylsilyl)cyclopentyl>malonate |