4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N,N',N'-tetramethyl-3-(10H-phenothiazin-10-yl)propane-1,2-diamine (1:1) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with N,N,N',N'-tetramethyl-3-(10H-phenothiazin-10-yl)propane-1,2-diamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94292-02-1 | Molecular Weight | 715.85600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H41N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-carboxy-3-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid,1-N,1-N,2-N,2-N-tetramethyl-3-phenothiazin-10-ylpropane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C42H41N3O6S |
|---|---|
| Molecular Weight | 715.85600 |
| Exact Mass | 715.27200 |
| PSA | 150.08000 |
| LogP | 8.23750 |
| InChIKey | RFNDYSMNFQCXJA-UHFFFAOYSA-N |
| SMILES | CN(C)CC(CN1c2ccccc2Sc2ccccc21)N(C)C.O=C(O)c1cc2ccccc2c(Cc2c(C(=O)O)c(O)cc3ccccc23)c1O |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic) acid,compound with N,N,N',N'-tetramethyl-3-(10H-phenothiazin-10-yl)propane-1,2-diamine (1:1) |
| EINECS 304-931-6 |