4-[2-(4-hydroxycyclohexyl)butan-2-yl]cyclohexan-1-ol structure
|
Common Name | 4-[2-(4-hydroxycyclohexyl)butan-2-yl]cyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 94315-49-8 | Molecular Weight | 254.40800 | |
| Density | 1.035g/cm3 | Boiling Point | 340.1ºC at 760mmHg | |
| Molecular Formula | C16H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7ºC | |
| Name | 4-[2-(4-hydroxycyclohexyl)butan-2-yl]cyclohexan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.035g/cm3 |
|---|---|
| Boiling Point | 340.1ºC at 760mmHg |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.40800 |
| Flash Point | 147.7ºC |
| Exact Mass | 254.22500 |
| PSA | 40.46000 |
| LogP | 3.50490 |
| InChIKey | WPGHRFLHOAGUSV-UHFFFAOYSA-N |
| SMILES | CCC(C)(C1CCC(O)CC1)C1CCC(O)CC1 |
|
~%
4-[2-(4-hydroxy... CAS#:94315-49-8 |
| Literature: Sheehan; Laubach Journal of the American Chemical Society, 1950 , vol. 72, p. 2478,2480 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,4'-sec-butylidene-bis-cyclohexanol |
| 4,4'-sec-Butyliden-bis-cyclohexanol |
| 4,4'-butane-2,2-diyldicyclohexanol |