1,8,9,10,11,12-hexahydrotricyclo[6.2.2.02,7]dodeca-3,9-diene-3,6-dione structure
|
Common Name | 1,8,9,10,11,12-hexahydrotricyclo[6.2.2.02,7]dodeca-3,9-diene-3,6-dione | ||
|---|---|---|---|---|
| CAS Number | 94324-60-4 | Molecular Weight | 188.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,8,9,10,11,12-hexahydrotricyclo[6.2.2.02,7]dodeca-3,9-diene-3,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O2 |
|---|---|
| Molecular Weight | 188.22200 |
| Exact Mass | 188.08400 |
| PSA | 34.14000 |
| LogP | 1.81100 |
| InChIKey | XQHRRFVFWWGRAN-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)C2=C1C1CCC2CC1 |
|
~99%
1,8,9,10,11,12-... CAS#:94324-60-4 |
| Literature: Rathore, Rajendra; Abdelwahed, Sameh H. Tetrahedron Letters, 2004 , vol. 45, # 27 p. 5267 - 5270 |
|
~%
1,8,9,10,11,12-... CAS#:94324-60-4 |
| Literature: Kitaguchi, Nobuya Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 3 p. 800 - 807 |
| 5,8-ethanotetrahydro-1,4-naphthoquinone |
| 5,6,7,8-tetrahydro-5,8-ethano-1,4-naphthoquinone |
| 1,4-Ethanonaphthalene-5,8-dione,1,2,3,4-tetrahydro |
| ghl.PD_Mitscher_leg0.294 |