1-(benzenesulfonyl)-2-methyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 1-(benzenesulfonyl)-2-methyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 943324-08-1 | Molecular Weight | 398.28400 | |
| Density | 1.24g/cm3 | Boiling Point | 577.6ºC at 760 mmHg | |
| Molecular Formula | C20H23BN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.1ºC | |
| Name | 1-(benzenesulfonyl)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 577.6ºC at 760 mmHg |
| Molecular Formula | C20H23BN2O4S |
| Molecular Weight | 398.28400 |
| Flash Point | 303.1ºC |
| Exact Mass | 398.14700 |
| PSA | 78.80000 |
| LogP | 3.96170 |
| Index of Refraction | 1.595 |
| InChIKey | XRBIXDGVQKMCJG-UHFFFAOYSA-N |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)c2cccnc2n1S(=O)(=O)c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| QC-364 |
| 2-METHYL-1-(PHENYLSULFONYL)-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRROLO[2,3-B]PYRIDINE |
| 1H-Pyrrolo[2,3-b]pyridine,2-methyl-1-(phenylsulfonyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) |