9H-Purin-2-amine,9-(phenylmethyl)-6-[(phenylmethyl)thio]- structure
|
Common Name | 9H-Purin-2-amine,9-(phenylmethyl)-6-[(phenylmethyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 94333-07-0 | Molecular Weight | 347.43700 | |
| Density | 1.33g/cm3 | Boiling Point | 636.8ºC at 760mmHg | |
| Molecular Formula | C19H17N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.9ºC | |
| Name | 9-benzyl-6-benzylsulfanylpurin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 636.8ºC at 760mmHg |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.43700 |
| Flash Point | 338.9ºC |
| Exact Mass | 347.12000 |
| PSA | 94.92000 |
| LogP | 4.33030 |
| Index of Refraction | 1.718 |
| InChIKey | DNNVKRLIFZPYGL-UHFFFAOYSA-N |
| SMILES | Nc1nc(SCc2ccccc2)c2ncn(Cc3ccccc3)c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Benzyl-2-amino-6-benzylmercapto-9H-purin |
| 9-benzyl-6-benzylsulfanyl-9H-purin-2-ylamine |
| HMS3092J15 |