[4-(aminomethyl)phenyl]-phenylmethanone
Modify Date: 2025-08-24 19:56:52
![[4-(aminomethyl)phenyl]-phenylmethanone Structure](https://image.chemsrc.com/caspic/213/94341-55-6.png)
[4-(aminomethyl)phenyl]-phenylmethanone structure
|
Common Name | [4-(aminomethyl)phenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 94341-55-6 | Molecular Weight | 211.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(aminomethyl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.25900 |
| Exact Mass | 211.10000 |
| PSA | 43.09000 |
| LogP | 3.07660 |
| InChIKey | UFQYYMAIVVSKPU-UHFFFAOYSA-N |
| SMILES | NCc1ccc(C(=O)c2ccccc2)cc1 |
|
~85%
[4-(aminomethyl... CAS#:94341-55-6 |
| Literature: Kan, Toshiyuki; Tominari, Yusuke; Rikimaru, Kentaro; Morohashi, Yuichi; Natsugari, Hideaki; Tomita, Taisuke; Iwatsubo, Takeshi; Fukuyama, Tohru Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 8 p. 1983 - 1985 |
|
~79%
[4-(aminomethyl... CAS#:94341-55-6 |
| Literature: Ge, Jingyan; Cheng, Xiamin; Tan, Lay Pheng; Yao, Shao Q. Chemical Communications, 2012 , vol. 48, # 37 p. 4453 - 4455 |
|
~%
[4-(aminomethyl... CAS#:94341-55-6 |
| Literature: BASF Aktiengesellschaft Patent: US5859084 A1, 1999 ; |
|
~%
[4-(aminomethyl... CAS#:94341-55-6 |
| Literature: Kan, Toshiyuki; Tominari, Yusuke; Rikimaru, Kentaro; Morohashi, Yuichi; Natsugari, Hideaki; Tomita, Taisuke; Iwatsubo, Takeshi; Fukuyama, Tohru Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 8 p. 1983 - 1985 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,[4-(aminomethyl)phenyl]phenyl |
| 4-aminomethylbenzophenone |
| (p-benzoylbenzyl)amine |
| 4-Aminomethyl-benzophenon |
| [4-(aminomethyl)phenyl]-phenyl-methanone |
| [(benzophenone-4-yl)methyl]amine |