4-(1-ethyl-3-methylindol-2-yl)phenol structure
|
Common Name | 4-(1-ethyl-3-methylindol-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 94343-55-2 | Molecular Weight | 251.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1-ethyl-3-methylindol-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NO |
|---|---|
| Molecular Weight | 251.32300 |
| Exact Mass | 251.13100 |
| PSA | 25.16000 |
| LogP | 4.34220 |
| InChIKey | SOOMMRUDZWCUDO-UHFFFAOYSA-N |
| SMILES | CCn1c(-c2ccc(O)cc2)c(C)c2ccccc21 |
|
~52%
4-(1-ethyl-3-me... CAS#:94343-55-2 |
| Literature: Golob, Thomas; Liebl, Renate; Von Angerer, Erwin Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 12 p. 3941 - 3953 |
|
~%
4-(1-ethyl-3-me... CAS#:94343-55-2 |
| Literature: Golob, Thomas; Liebl, Renate; Von Angerer, Erwin Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 12 p. 3941 - 3953 |
| Phenol,4-(1-ethyl-3-methyl-1H-indol-2-yl) |