Methyl 2,4-dihydroxy-5-isopropylbenzoate structure
|
Common Name | Methyl 2,4-dihydroxy-5-isopropylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 943519-37-7 | Molecular Weight | 210.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2,4-dihydroxy-5-propan-2-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14O4 |
|---|---|
| Molecular Weight | 210.22600 |
| Exact Mass | 210.08900 |
| PSA | 66.76000 |
| LogP | 2.00780 |
| InChIKey | NAOCXJWZGXUTCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)C)c(O)cc1O |
| HS Code | 2918199090 |
|---|
|
~99%
Methyl 2,4-dihy... CAS#:943519-37-7 |
| Literature: ASTEX THERAPEUTICS LIMITED; WILLIAMS, Marian Patent: WO2009/125230 A1, 2009 ; Location in patent: Page/Page column 102 ; |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,4-dihydroxy-5-isopropylbenzoic acid methyl ester |
| QC-4440 |
| methyl 2,4-dihydroxy-5-isopropylbenzoate |