Methyl 4-[(4-oxo-1-piperidinyl)methyl]benzoate structure
|
Common Name | Methyl 4-[(4-oxo-1-piperidinyl)methyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 943767-91-7 | Molecular Weight | 247.290 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 388.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6±25.1 °C | |
| Name | Benzoic acid, 4-[(4-oxo-1-piperidinyl)methyl]-, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.2±32.0 °C at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.290 |
| Flash Point | 188.6±25.1 °C |
| Exact Mass | 247.120850 |
| PSA | 46.61000 |
| LogP | 1.16 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | KWNMPBHHMPXVQP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CN2CCC(=O)CC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 4-[(4-oxo-1-piperidinyl)methyl]benzoate |
| methyl 4-((4-oxopiperidin-1-yl)methyl)benzoate |
| Benzoic acid, 4-[(4-oxo-1-piperidinyl)methyl]-, methyl ester |
| Methyl 4-[(4-oxopiperidin-1-yl)methyl]benzoate |