(3,4-dinitrophenyl)boronic acid structure
|
Common Name | (3,4-dinitrophenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 943828-23-7 | Molecular Weight | 211.92500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5BN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dinitrophenyl)boronic acid |
|---|
| Molecular Formula | C6H5BN2O6 |
|---|---|
| Molecular Weight | 211.92500 |
| Exact Mass | 212.02400 |
| PSA | 132.10000 |
| LogP | 0.22920 |
| InChIKey | UPHSQBGGOHFKOQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(B(O)O)cc1[N+](=O)[O-] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |