2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarbonitrile structure
|
Common Name | 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 94398-02-4 | Molecular Weight | 278.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10N4O2 |
|---|---|
| Molecular Weight | 278.26600 |
| Exact Mass | 278.08000 |
| PSA | 106.29000 |
| LogP | 3.54016 |
| InChIKey | MAGGLMPGYBCPIG-UHFFFAOYSA-N |
| SMILES | Cc1nc(C)c(C#N)c(-c2ccccc2[N+](=O)[O-])c1C#N |
|
~%
2,6-dimethyl-4-... CAS#:94398-02-4 |
| Literature: Courts; Petrow Journal of the Chemical Society, 1952 , p. 1,4 |
|
~%
2,6-dimethyl-4-... CAS#:94398-02-4 |
| Literature: Courts; Petrow Journal of the Chemical Society, 1952 , p. 1,4 |
| 2,6-dimethyl-4-(2-nitro-phenyl)-pyridine-3,5-dicarbonitrile |
| 2,6-Dimethyl-4-(2-nitro-phenyl)-pyridin-3,5-dicarbonitril |
| 3,5-Pyridinedicarbonitrile,2,6-dimethyl-4-(2-nitrophenyl) |