NHS-PEG4-azide structure
|
Common Name | NHS-PEG4-azide | ||
|---|---|---|---|---|
| CAS Number | 944251-24-5 | Molecular Weight | 388.373 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NHS-PEG4-azideN3-PEG4-C2-NHS ester is a nonclaevable 4-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | N3-PEG4-C2-NHS ester is a nonclaevable 4-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Molecular Formula | C15H24N4O8 |
|---|---|
| Molecular Weight | 388.373 |
| Exact Mass | 388.159424 |
| PSA | 150.35000 |
| LogP | -2.59 |
| InChIKey | OIGKWPIMJCPGGD-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Azido-PEG4-NHS ester |
| N-Succinimidyl 15-Azido-4,7,10,13-tetraoxapentadecanoate |
| 15-Azido-4,7,10,13-tetraoxapentadecanoic Acid N-Succinimidyl Ester |
| NHS-PEG4-Azide |
| AmbotzPEG1400 |
| 1-[(1-Azido-15-oxo-3,6,9,12-tetraoxapentadecan-15-yl)oxy]-2,5-pyrrolidinedione |