Ethyl 2-bromo-1-naphthoate
Modify Date: 2026-07-14 15:47:33
Ethyl 2-bromo-1-naphthoate structure
|
Common Name | Ethyl 2-bromo-1-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 944276-70-4 | Molecular Weight | 279.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-bromo-1-naphthoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11BrO2 |
|---|---|
| Molecular Weight | 279.13 |
| InChIKey | DDVXCDUXTFEUSO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(Br)ccc2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethyl 2-bromo-1-naphthoate? |
| A: Molecular weight of Ethyl 2-bromo-1-naphthoate is 279.13. |
| Q: What is the CAS number of Ethyl 2-bromo-1-naphthoate? |
| A: CAS number of Ethyl 2-bromo-1-naphthoate is 944276-70-4. |
| Q: What is the SMILES notation of Ethyl 2-bromo-1-naphthoate? |
| A: SMILES notation of Ethyl 2-bromo-1-naphthoate is CCOC(=O)c1c(Br)ccc2ccccc12. |
| Q: What is the Chinese name of 944276-70-4? |
| A: Chinese name of 944276-70-4 is 944276-70-4. |
| Q: What is the InChIKey of Ethyl 2-bromo-1-naphthoate? |
| A: InChIKey of Ethyl 2-bromo-1-naphthoate is DDVXCDUXTFEUSO-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 2-bromo-1-naphthoate? |
| A: The English name of Ethyl 2-bromo-1-naphthoate is Ethyl 2-bromo-1-naphthoate. |
| Q: What is the molecular formula of Ethyl 2-bromo-1-naphthoate? |
| A: Molecular formula of Ethyl 2-bromo-1-naphthoate is C13H11BrO2. |