1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine
Modify Date: 2026-07-10 20:00:33
![1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine Structure](https://www.chemsrc.com/extcaspic/093/944348-83-8.png)
1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine structure
|
Common Name | 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 944348-83-8 | Molecular Weight | 247.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO2 |
|---|---|
| Molecular Weight | 247.33 |
| InChIKey | JMQOARFGCMLECS-UHFFFAOYSA-N |
| SMILES | CNCC1(c2ccc3c(c2)OCO3)CCCCC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Functional Uptake Assay (hNET) from US Patent US10562878: "Cycloalkylamines as monoam...
Source: BindingDB
Target: N/A
External Id: BindingDB_8977_2
|
|
Name: Functional Uptake Assay (hSERT) from US Patent US10562878: "Cycloalkylamines as monoa...
Source: BindingDB
Target: N/A
External Id: BindingDB_8977_1
|
|
Name: Functional Uptake Assay (hDAT) from US Patent US10562878: "Cycloalkylamines as monoa...
Source: BindingDB
Target: N/A
External Id: BindingDB_8977_3
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine? |
| A: InChIKey of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine is JMQOARFGCMLECS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine? |
| A: SMILES notation of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine is CNCC1(c2ccc3c(c2)OCO3)CCCCC1. |
| Q: What is the English name of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine? |
| A: The English name of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine is 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine. |
| Q: What is the molecular formula of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine? |
| A: Molecular formula of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine is C15H21NO2. |
| Q: What is the molecular weight of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine? |
| A: Molecular weight of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine is 247.33. |
| Q: What is the CAS number of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine? |
| A: CAS number of 1-(1-(benzo[d][1,3]dioxol-5-yl)cyclohexyl)-N-methylmethanamine is 944348-83-8. |
| Q: What is the Chinese name of 944348-83-8? |
| A: Chinese name of 944348-83-8 is 944348-83-8. |