Phenol, 2-amino-4,6-bis(trifluoromethyl) structure
|
Common Name | Phenol, 2-amino-4,6-bis(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 944356-99-4 | Molecular Weight | 245.12200 | |
| Density | 1.559±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 203.0±40.0 °C (760 mmHg) | |
| Molecular Formula | C8H5F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phenol, 2-amino-4,6-bis(trifluoromethyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 203.0±40.0 °C (760 mmHg) |
| Molecular Formula | C8H5F6NO |
| Molecular Weight | 245.12200 |
| Exact Mass | 245.02800 |
| PSA | 46.25000 |
| LogP | 3.59320 |
| InChIKey | BBLGGFMZPYQWAN-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-4,6-bis(trifluoromethyl)phenol |
| 2-(HYDROXY)-3,5-BIS(TRIFLUOROMETHYL)ANILINE |