2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate
Modify Date: 2026-07-08 17:28:06
2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate structure
|
Common Name | 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 944410-02-0 | Molecular Weight | 308.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H16O4 |
|---|---|
| Molecular Weight | 308.3 |
| InChIKey | FUVYGQMBHDNASK-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(C(=O)Oc2ccc3ccc(=O)oc3c2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 944410-02-0? |
| A: Chinese name of 944410-02-0 is 944410-02-0. |
| Q: What is the English name of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate? |
| A: The English name of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate is 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate. |
| Q: What is the SMILES notation of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate? |
| A: SMILES notation of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate is CCCc1ccc(C(=O)Oc2ccc3ccc(=O)oc3c2)cc1. |
| Q: What is the molecular formula of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate? |
| A: Molecular formula of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate is C19H16O4. |
| Q: What is the molecular weight of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate? |
| A: Molecular weight of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate is 308.3. |
| Q: What is the InChIKey of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate? |
| A: InChIKey of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate is FUVYGQMBHDNASK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate? |
| A: CAS number of 2-Oxo-2H-1-benzopyran-7-yl 4-propylbenzoate is 944410-02-0. |