2-Methyl-2-propanyl 2-(2,4-dimethoxybenzyl)-1-oxo-2,5-diazaspiro[ 3.4]octane-5-carboxylate structure
|
Common Name | 2-Methyl-2-propanyl 2-(2,4-dimethoxybenzyl)-1-oxo-2,5-diazaspiro[ 3.4]octane-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 94459-10-6 | Molecular Weight | 376.44700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-2-propanyl 2-(2,4-dimethoxybenzyl)-1-oxo-2,5-diazaspiro[ 3.4]octane-5-carboxylate |
|---|
| Molecular Formula | C20H28N2O5 |
|---|---|
| Molecular Weight | 376.44700 |
| Exact Mass | 376.20000 |
| PSA | 68.31000 |
| LogP | 2.69150 |
| InChIKey | YVEXQNLCERIWJZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CC3(CCCN3C(=O)OC(C)(C)C)C2=O)c(OC)c1 |
|
~%
2-Methyl-2-prop... CAS#:94459-10-6 |
| Literature: Overman, Larry E.; Osawa, Tatsushi Journal of the American Chemical Society, 1985 , vol. 107, # 6 p. 1698 - 1701 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |