2-[3,5-bis(2-hydroxyethylamino)-2,4,6-trinitroanilino]ethanol structure
|
Common Name | 2-[3,5-bis(2-hydroxyethylamino)-2,4,6-trinitroanilino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 94467-76-2 | Molecular Weight | 390.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3,5-bis(2-hydroxyethylamino)-2,4,6-trinitroanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18N6O9 |
|---|---|
| Molecular Weight | 390.30600 |
| Exact Mass | 390.11400 |
| PSA | 234.24000 |
| LogP | 1.41240 |
| InChIKey | BNULYKZFUFELNU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(NCCO)c([N+](=O)[O-])c(NCCO)c([N+](=O)[O-])c1NCCO |
|
~88%
2-[3,5-bis(2-hy... CAS#:94467-76-2 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US5081255 A1, 1992 ; |
| N,N',N''-Tris-(2-hydroxy-aethyl)-2,4,6-trinitro-benzen-1,3,5-triyltriamin |
| N,N',N''-tris-(2-hydroxy-ethyl)-2,4,6-trinitro-benzene-1,3,5-triyltriamine |
| 2,4,6-trinitro-1,3,5-tris(2-hydroxyethylamino)benzene |
| Ethanol,2,2',2''-[(2,4,6-trinitro-1,3,5-benzenetriyl)triimino]tris |
| 1,3,5-Tris-(2-hydroxy-aethylamino)-2,4,6-trinitro-benzol |