tert-butyl N-(5-bromo-4-cyano-1,3-thiazol-2-yl)carbamate structure
|
Common Name | tert-butyl N-(5-bromo-4-cyano-1,3-thiazol-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 944804-80-2 | Molecular Weight | 304.164 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10BrN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-(5-bromo-4-cyano-1,3-thiazol-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H10BrN3O2S |
| Molecular Weight | 304.164 |
| Exact Mass | 302.967712 |
| PSA | 103.25000 |
| LogP | 1.88 |
| Index of Refraction | 1.587 |
| InChIKey | OLBIHOOXHIFIHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C#N)c(Br)s1 |
| HS Code | 2934100090 |
|---|
|
~%
tert-butyl N-(5... CAS#:944804-80-2 |
| Literature: AMGEN INC. Patent: US2007/173506 A1, 2007 ; Location in patent: Page/Page column 53; 53-54 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| tert-butyl 5-bromo-4-cyanothiazol-2-ylcarbamate |
| Carbamic acid, N-(5-bromo-4-cyano-2-thiazolyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (5-bromo-4-cyano-1,3-thiazol-2-yl)carbamate |
| N-Boc-2-Amino-5-bromothiazole-4-carbonitrile |