3-(4-methyl-6-oxo-2-sulfanylidene-3H-pyrimidin-5-yl)propanoic acid structure
|
Common Name | 3-(4-methyl-6-oxo-2-sulfanylidene-3H-pyrimidin-5-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 945-12-0 | Molecular Weight | 214.24200 | |
| Density | 1.44g/cm3 | Boiling Point | 481.7ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.1ºC | |
| Name | 3-(6-methyl-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 481.7ºC at 760 mmHg |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.24200 |
| Flash Point | 245.1ºC |
| Exact Mass | 214.04100 |
| PSA | 118.04000 |
| LogP | 0.75810 |
| Index of Refraction | 1.63 |
| InChIKey | XXPAJXVOQAZZJC-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=S)[nH]c(=O)c1CCC(=O)O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |