2-Chloro-N-(Diphenylmethyl)Propanamide structure
|
Common Name | 2-Chloro-N-(Diphenylmethyl)Propanamide | ||
|---|---|---|---|---|
| CAS Number | 94500-97-7 | Molecular Weight | 273.75700 | |
| Density | 1.156g/cm3 | Boiling Point | 460.7ºC at 760mmHg | |
| Molecular Formula | C16H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.4ºC | |
| Name | N-benzhydryl-2-chloropropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 460.7ºC at 760mmHg |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.75700 |
| Flash Point | 232.4ºC |
| Exact Mass | 273.09200 |
| PSA | 32.59000 |
| LogP | 4.35980 |
| Index of Refraction | 1.571 |
| InChIKey | ILGVBQOLUMYGSZ-UHFFFAOYSA-N |
| SMILES | CC(Cl)C(=O)NC(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzhydryl-2-chloro-propionamide |
| (2R)-2-chloro-N-(diphenylmethyl)propanamide |